Lycopeen: verschil tussen versies

172 bytes verwijderd ,  2 jaar geleden
geen GHS beschikbaar voor deze stof
k (Taalpoetsje)
(geen GHS beschikbaar voor deze stof)
| Naam = Lycopeen
| afbeelding1 = Lycopene.svg
| onderschrift1 = Structuur[[Structuurformule]] van lycopeen
| afbeelding2 = Lycopene powder.jpg
| onderschrift2 = Lycopeenpoeder
| onderschrift4 =
| Formule = C<sub>40</sub>H<sub>56</sub>
| Molgewicht = 536,873
| SMILES = Zie voetnoot<ref>SMILES (symbolische structuurweergave) = <br /> CC(=CCC/C(=C/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C=C(\C)/CCC=C(C)C)/C)/C)/C)C<!--De Smiles specificatie maakte de infobox veel te breed en de specificatie bleek niet in te korten. Vandaar deze verplaatsing naar een voetnoot. --></ref>
| InChI = 1/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-<br />40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+
| IUPAC = (6E,8E,10E,12E,14E,16E,18E, 20E,22E,24E,26E)-2,6,10,14,19,23,27,31-octamethyldotriaconta-2,6,8,10, 12,14,16,18,20,22,24,26,30-tridecaeen
| AndereNamen = ψ,ψ-caroteen;, all-''trans''-lycopeen
| CAS = 502-65-8
| EINECS = 207-949-1
| VN =
| PubChem = 446925
| Beschrijving = dieprood pigment
| Vergelijkbaar =
| AfbWaarsch = {{Pictogram GHS}}
| TekstWaarsch =
| Carcinogeen =
| LethaalKonijn =
| MSDS =
| Aggregatie = vast
| Kleur = dieprood
| Dichtheid =
| MolgewichtSmeltpunt = 536,873175
| Smeltpunt = 173
| Kookpunt =
| Vlampunt =
5.431

bewerkingen