Diheptylftalaat
chemische verbinding
Diheptylftalaat of DHP (Engels: diheptyl phthalate) is een organische verbinding met als brutoformule C22H34O4. De stof komt voor als een reukloze kleurloze vloeistof, die zeer slecht oplosbaar is in water.
| Diheptylftalaat | ||||
|---|---|---|---|---|
| Structuurformule en molecuulmodel | ||||
| ||||
Structuurformule van diheptylftalaat
| ||||
| Algemeen | ||||
| Molecuulformule | C22H34O4 | |||
| IUPAC-naam | diheptylbenzeen-1,2-dicarboxylaat | |||
| Andere namen | DHP, di-n-heptylftalaat | |||
| Molmassa | 362,50296 g/mol | |||
| SMILES | CCCCCCCOC(=O)C1=CC=CC=C1C(=O)OCCCCCCC
| |||
| InChI | 1S/C22H34O4/c1-3-5-7-9-13-17-25-21(23)19- 15-11-12-16-20(19)22(24)26-18-14-10-8-6-4- 2/h11-12,15-16H,3-10,13-14,17-18H2,1-2H3
| |||
| CAS-nummer | 3648-21-3 | |||
| EG-nummer | 222-885-4 | |||
| PubChem | 19284 | |||
| Wikidata | Q2943515 | |||
| Beschrijving | Kleurloze vloeistof | |||
| Waarschuwingen en veiligheidsmaatregelen | ||||
| ||||
| H-zinnen | H315 - H319 - H335 - H361 | |||
| EUH-zinnen | geen | |||
| P-zinnen | P261 - P281 - P305+P351+P338 | |||
| Fysische eigenschappen | ||||
| Aggregatietoestand | vloeibaar | |||
| Kleur | kleurloos | |||
| Dichtheid | 0,992 g/cm³ | |||
| Kookpunt | 360 °C | |||
| Vlampunt | (gesloten vat) 224 °C | |||
| Dampdruk | (bij 20°C) 0,2 Pa | |||
| Slecht oplosbaar in | water | |||
| log(Pow) | ± 7,6 | |||
| Tenzij anders vermeld zijn standaardomstandigheden gebruikt (298,15 K of 25 °C, 1 bar). | ||||
| ||||
Diheptylftalaat wordt gebruikt als weekmaker.
