Framycetine: verschil tussen versies

227 bytes toegevoegd ,  4 maanden geleden
k
geen bewerkingssamenvatting
k
 
| afbeelding = Framycetin.png
| onderschrift =
| IUPAC = IUPACnaam<ref>IUPACnaam: (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2-[(2S,3R,4S,5R)-4-[(2R,3R,4R,5S,6S)-3-amino-6-(aminomethyl)-4,5-dihydroxyoxan-2-yl]oxy-3-hydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-3-hydroxycyclohexyl]oxyoxaan-3,4-diol</ref>
| beschikbaarheid =
| metabolisatie =
| repertorium =
| chemische_formule = C<sub>23</sub>H<sub>46</sub>N<sub>6</sub>O<sub>13</sub>
| smiles = Smiles<ref>Smiles: O([C@H]3[C@H](O[C@@H]2O[C@H](CO)[C@@H](O[C@H]1O[C@@H](CN)[C@@H](O)[C@H](O)[C@H]1N)[C@H]2O)[C@@H](O)[C@H](N)C[C@@H]3N)[C@H]4O[C@@H]([C@@H](O)[C@H](O)[C@H]4N)CN</ref>
| moleculair_gewicht =614,644
| smeltpunt =
| aggregatietoestand =
}}
 
'''Framycetine''', ook '''neomycine B''' genoemd, is een [[aminoglycoside]] [[antibioticum]] dat vergelijkbaar is met [[neomycine]]. Het wordt gebruikt in preparaten om infecties van de huid, neus, oren of ogen te behandelen; meestal in combinatiepreparaten met andere antibacteriële geneesmiddelen en/of [[corticosteroïde]]n.