Luteoline-7-glucoside: verschil tussen versies

146 bytes verwijderd ,  3 jaar geleden
geen GHS beschikbaar voor deze stof
k (Linkfix ivm sjabloonnaamgeving / parameterfix)
(geen GHS beschikbaar voor deze stof)
 
| onderschrift4 =
| Formule = C<sub>21</sub>H<sub>20</sub>O<sub>11</sub>
| Molgewicht = 448,10
| SMILES = Zie voetnoot<ref>SMILES (symbolische structuurweergave) = <br />C1=CC(=C(C=C1C2=CC(=O)C3=C(C=C(C=C3O2)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O)O)O)O)O
(O4)CO)O)O)O)O)O)O</ref>
| IUPAC = 2-(3,4-dihydroxyfenyl)-5-hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-on
hydroxy-7-[(2S,3R,4S,5S,6R)-3,4,
5-trihydroxy-6-(hydroxymethyl)oxan-
2-yl]oxychromen-4-on
| AndereNamen = cynaroside, cymaroside, glucoluteoline, 7-O-beta-D-Glucosyl-5,7,3',4'-tetrahydroxyflavon
| CAS = 5373-11-5
| VN =
| PubChem = 5280637
| Beschrijving = geel poeder
| Vergelijkbaar =
| AfbWaarsch = {{Pictogram GHS|}}
| TekstWaarsch =
| Carcinogeen =
| Kleur = geel
| Dichtheid =
| Molgewicht = 448,10
| Smeltpunt = 243
| Kookpunt =
}}
 
'''Luteoline-7-glucoside''' of '''cynaroside''' is een [[flavonoïde]] [[glycoside]] dat onder meer te vinden is in [[wolfspoot]], [[artisjok]] en [[Olijf|olijven]].<ref>http://www.liberherbarum.com/Minor/UK/IN3315.htm</ref>. [[Wilg]]en gebruiken deze stof als [[chemo-attractant]] voor de [[kevers|kever]] ''[[Chrysomela vigintipunctata]]''.<ref>[[Jeffrey B. Harborne]], ''Phytochemical Dictionary: A Handbook of Bioactive Compounds from Plants'', CRC Press, 1999 </ref>
 
{{Appendix|2=
{{References}}
}}
{{Beginnetje|scheikunde|2=2008|3=03|4=19}}
 
[[Categorie:Flavonoïde]]
5.514

bewerkingen