Glucuronzuur: verschil tussen versies

1.731 bytes toegevoegd ,  7 jaar geleden
k
geen bewerkingssamenvatting
k (l;ink tioegevoegsd)
kGeen bewerkingssamenvatting
{{Infobox chemische stof
'''Glucuronzuur''' (uit het [[Oudgrieks]] ''γλυκύς'' "zoet" + οὖρον "urine") is een [[carbonzuur]]. De structuur lijkt op die van [[glucose]], maar het zesde koolstofatoom is geoxideerd tot een zuurgroep. De brutoformule is [[koolstof|C]]<sub>6</sub>[[waterstof (element)|H]]<sub>10</sub>[[zuurstof (element)|O]]<sub>7</sub>.
| Naam = Glucuronzuur
| afbeelding1 = Beta D-Glucuronic acid.svg
| onderschrift1 = β-D-Glucuronzuur, de Monosacharide#Ringvorm of lineaire keten|pyranosevorm]] van het zuur.
| afbeelding2 =
| onderschrift2 =
| afbeelding3 =
| onderschrift3 =
| afbeelding4 =
| onderschrift4 =
| Formule = C<sub>6</sub>H<sub>10</sub>O<sub>7</sub>
| Molgewicht = 194,14<ref>Standaard atoommassa's bij elkaar tellen.</ref>
| SMILES = O=C(O)[C@H]1O[C@H](O)[C@H](O)[C@@H](O)[C@@H]1O
| InChI =
| IUPAC = (2''S'',3''S'',4''S'',5''R'',''6''R)-3,4,5,6-&#x200b;Tetrahydroxyoxane-2-carbonzuur
| AndereNamen = β-<small>D</small>-glucopyranuronzuur
| CAS = 6556-12-3
| EINECS =
| EG =
| VN =
| PubChem =441478
| Beschrijving =
| Vergelijkbaar =
| AfbWaarsch =
| TekstWaarsch =
| Rzinnen =
| EUHzinnen =
| Szinnen =
| Carcinogeen =
| Hygroscopisch =
| Omgang =
| Opslag =
| ADR =
| MAC =
| LethaalRat =
| LethaalKonijn =
| LethaalMuis =
| LethaalKip =
| Aggregatie =
| Kleur =
| Dichtheid =
| Smeltpunt = <ref>[http://www.sigmaaldrich.com/catalog/product/sigma/g5269?lang=en&region=US D-Glucuronic acid] at [[Sigma-Aldrich]]</ref>159 - 161
| Kookpunt =
| Sublimatiepunt =
| Vlampunt =
| Zelfontbranding =
| Dampdruk =
| Brekingsindex =
| Oplosbaarheid =
| GoedOplIn =
| MatigOplIn =
| SlechtOplIn =
| OnoplIn =
| Dipoolmoment =
| LogPow =
| Viscositeit =
| Kristalstructuur =
| fG0g =
| fG0l =
| fG0s =
| fH0g =
| fH0l =
| fH0s =
| S0g =
| S0l =
| S0s =
| Cpm0 =
| Evenwicht =
| KlassiekeAnalyse =
| Spectra =
| NutrientType =
| Essentieel =
| Voorkomen =
| ADI =
| AdditiefType =
| E-nummer =
}}
 
'''Glucuronzuur''' (uit het [[Oudgrieks]] ''γλυκύς'' "zoet" + οὖρον "urine") is een [[carbonzuur]]. De structuur lijkt op die van [[glucose]], maar het zesde koolstofatoom is geoxideerd tot een zuurgroep. De brutoformule is [[koolstof|C]]<sub>6</sub>[[waterstof (element)|H]]<sub>10</sub>[[zuurstof (element)|O]]<sub>7</sub>. De stof mag niet verward worden met [[gluconzuur]], het standaard [[oxidatie]]product in tal van [[aantoningsreactie]]s van glucose.
 
==Functies==