Lycopeen: verschil tussen versies

58 bytes verwijderd ,  8 jaar geleden
k
geen bewerkingssamenvatting
k
| Naam = Lycopeen
| afbeelding1 = Lycopene.svg
| afbeeldingbreedte1 = 350
| onderschrift1 = Structuur van lycopeen
| afbeelding2 = Lycopene powder.jpg
| afbeeldingbreedte2 = 300
| onderschrift2 = Lycopeenpoeder
| afbeelding3 =
| SMILES = Zie voetnoot<ref>SMILES (symbolische structuurweergave) = <br /> CC(=CCC/C(=C/C=C/C(=C/C=C/C(=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C=C(\C)/CCC=C(C)C)/C)/C)/C)C<!--De Smiles specificatie maakte de infobox veel te breed en de specificatie bleek niet in te korten. Vandaar deze verplaatsing naar een voetnoot. --></ref>
| InChI = 1/C40H56/c1-33(2)19-13-23-37(7)27-17-31-39(9)29-15-25-35(5)21-11-12-22-36(6)26-16-30-<br />40(10)32-18-28-38(8)24-14-20-34(3)4/h11-12,15-22,25-32H,13-14,23-24H2,1-10H3/b12-11+,25-15+,26-16+,31-17+,32-18+,35-21+,36-22+,37-27+,38-28+,39-29+,40-30+
| IUPAC = (6E,8E,10E,12E,14E,16E,18E, 20E,22E,24E,26E)-2,6,10,14,19,23,27,31-<br />octamethyldotriaconta-2,6,8,10, 12,14,16,18,20,22,24,26,30-tridecaeen
| AndereNamen = ψ,ψ-caroteen; all-''trans''-lycopeen
| CAS = 502-65-8
131.676

bewerkingen