Trifenylfosfaat: verschil tussen versies

209 bytes toegevoegd ,  10 jaar geleden
+ GHS (bron: Sigma Aldrich)
(GHS-symbool verbeterd)
(+ GHS (bron: Sigma Aldrich))
| afbeeldingbreedte1 = 175
| onderschrift1 = [[Structuurformule]] van trifenylfosfaat
| afbeelding2 = Triphenyl-phosphate-3D-vdW.png
| onderschrift2 =
| afbeeldingbreedte2 = 175
| onderschrift2 = [[Molecuulmodel]] van trifenylfosfaat
| afbeelding3 =
| onderschrift3 =
| onderschrift4 =
| Formule = C<sub>18</sub>H<sub>15</sub>O<sub>4</sub>P
| Molgewicht = 326,28283062
| SMILES =
| SMILES = C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3
| IUPAC = Trifenylfosfaat
| InChI = 1S/C18H15O4P/c19-23(20-16-10-4-1-5-11-16,21-17-12-6-2-7-13-17)22-18-14-8-3-9-15-18/h1-15H
| AndereNamen = Fosforzure trifenylester
| IUPAC = trifenylfosfaat
| AndereNamen =
| CAS = 115-86-6
| EINECS =
| Vergelijkbaar =
| AfbWaarsch = {{Pictogram GHS|N}}
| TekstWaarsch = Waarschuwing
| Carcinogeen =
| Hygroscopisch =
| Rzinnen = {{H400}}
| SzinnenEUHzinnen = ''geen''
| Szinnen = {{P273}}
| Omgang =
| Opslag =
| Kleur = kleurloos
| Dichtheid = 1,184
| Molgewicht = 326,28
| Smeltpunt = 48-50
| Kookpunt = 244
}}
 
'''Trifenylfosfaat''' is een [[organische verbinding]], met name een [[triarylfosfaatester]] met als [[brutoformule]] C<sub>18</sub>H<sub>15</sub>O<sub>4</sub>P. Het is een kleurloos [[kristallijn]] [[poeder]] met een kenmerkende geur. De stof wordt gebruikt als [[weekmaker]] en als [[vlamvertrager]]. Bij verhitting van de stof worden giftige dampen gevormd.
 
== Synthese ==
Trifenylfosfaat wordt [[Chemische synthese|gesynthetiseerd]] uit een reactie van [[Fosforylchloride|fosforoxychloridefosforylchloride]] en [[fenol]], in een [[Base (scheikunde)|basisch milieu]]:
 
:<math>\mathrm{POCl_3\ +\ 3\ C_6H_6O \longrightarrow\ C_{18}H_{15}O_4P\ +\ 3\ HCl}</math>
== Externe links==
* {{Link International Chemical Safety Card|id=1062}}
* {{Link GESTIS|ZVG=18550}}
* {{en}} [http://www.sciencelab.com/msds.php?msdsId=9925341 MSDS van ''trifenylfosfaat'']
 
[[Categorie:Vlamvertrager]]
131.676

bewerkingen