Dodecylgallaat: verschil tussen versies

39 bytes toegevoegd ,  9 jaar geleden
+ GHS (bron: Sigma Aldrich)
k (r2.7.1) (robot Anders: es:Galato de dodecilo)
(+ GHS (bron: Sigma Aldrich))
| SMILES = CCCCCCCCOC(=O)C1=CC(=C(C(=C1)O)O)O
| InChI =
| IUPAC = Dodecyldodecyl-3,4,5-trihydroxybenzoaat
| AndereNamen =
| AndereNamen = dodecylgallaat; laurylgallaat; ''n''-dodecyl- (of lauryl-)ester van 3,4,5-trihydroxybenzoëzuur; E312
| CAS = 1166-52-5
| EINECS = 214-620-6
| PubChem =
| Beschrijving = witWitte tot crèmekleurige, reukloze vaste stof
| Vergelijkbaar = [[propylgallaat]];, [[octylgallaat]]
| AfbWaarsch = {{Pictogram GHS|X}}
| TekstWaarsch = Waarschuwing
| Carcinogeen =
| Hygroscopisch =
| Rzinnen = {{R43H317}}
| EUHzinnen = ''geen''
| Szinnen = {{S2}} - {{S24}} - {{S37P280}}
| Omgang =
| Opslag =
| EG = 607-200-00-2
| VN =
| ADR =
| ADR = <!-- Gevarenklasse volgens ADR -->
| MAC =
| LethaalRat = ([[oraal:]]) 6500<ref>[http://www.inchem.org/documents/jecfa/jecmono/v38aje04.htm Propyl gallate (FAO Nutrition Meetings Report Series 38a)]</ref>
| LethaalKonijn =
| LethaalMuis =
| Zelfontbranding =
| Dampdruk =
| Oplosbaarheid = <!-- g/l -->
| GoedOplIn = vetten;, ethanol;, etherdiethylether
| MatigOplIn =
| SlechtOplIn =
| OnoplIn = water
| LogPow =
| LogPow = <!-- octanol/water partitiecoëfficiënt -->
| Viscositeit =
| Brekingsindex =
| S0s =
| Cpm0 =
| Evenwicht = <!-- evenwichtsconstante (pKa-waarde) -->
| KlassiekeAnalyse =
| Spectra =
| Essentieel =
| Voorkomen =
| ADI =
| ADI = (niet bepaald)<ref>[http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-170.pdf JECFA specificatie (1996)] (tijdelijke ADI uit 1993 werd ingetrokken)</ref>
| AdditiefType = antioxidant
| E-nummer = 311
}}
'''Dodecylgallaat''' of '''laurylgallaat''' is de [[esterEster (chemie)|ester]] van [[galluszuur]] en [[dodecanol|1-dodecanol]] (ook gekend als laurylalcohol). Het is een wit tot crèmekleurige [[vaste stof]].
 
== Toepassingen ==
Dodecylgallaat is een [[antioxidant]] en is toegelaten als synthetisch voedingsadditief met [[E-nummer]] E312. Het wordt gebruikt in olie- en vetrijke producten. Het effect ervan is groter in combinatie met [[citroenzuur]] als [[synergie|synergist]].
 
De esters [[propylgallaat]] (E310) en [[octylgallaat]] (E311) zijn ook toegelaten antioxidanten. De tijdelijke [[Aanvaardbare Dagelijkse Inname|ADI]] uit [[1993]] werd ingetrokken en is later niet meer bepaald.<ref>[http://www.fao.org/ag/agn/jecfa-additives/specs/Monograph1/Additive-170.pdf JECFA specificatie (1996)]</ref>
 
== Externe links ==
*{{en}} [http://www.chemcas.com/AnalyticalDetail.asp?pidx=1&id=17623&cas=1166-52-5&page=441 MSDS van ''dodecylgallaat'']
 
{{Refs}}
131.676

bewerkingen