Lugdunaam: verschil tussen versies

70 bytes toegevoegd ,  11 jaar geleden
fix ivm layout
k (link van dp naar juiste pagina, Replaced: varkenvarken, met AWB)
(fix ivm layout)
| Formule = C<sub>18</sub>H<sub>16</sub>N<sub>4</sub>O<sub>4</sub>
| Molgewicht = 352,35
| SMILES = Zie voetnoot<ref>SMILES (symbolische structuurweergave) = <br />OC(CN/C(NC3=CC=C(C#N)C=C3)=N\CC1=CC=CC2=C1OCO2)=O</ref>
| IUPAC =
| AndereNamen =
120.421

bewerkingen