Lugdunaam: verschil tussen versies

1 byte verwijderd ,  11 jaar geleden
Linkfix ivm sjabloonnaamgeving met AWB
k (cat)
(Linkfix ivm sjabloonnaamgeving met AWB)
{{Infobox chemische stof
{{ChemischeStof|
| Naam = {{PAGENAME}}Lugdunaam
| Afb1 = [[AfbeeldingBestand:Lugduname.png|200px]]
| Afb1Omschr = Structuur van lugdunaam
| Afb2 =
| Afb4Omschr =
| Formule = C<sub>18</sub>H<sub>16</sub>N<sub>4</sub>O<sub>4</sub>
| Molgewicht = 352,35
| SMILES = OC(CN/C(NC3=CC=C(C#N)C=C3)=N\CC1=CC=CC2=C1OCO2)=O
| IUPAC =
| AdditiefType = zoetstof
| E-nummer =
 
}}
 
<references />
 
[[Categorie: Zoetstof]]
[[Categorie:Guanidine]]
[[Categorie:Nitril]]