Luteoline-7-glucoside: verschil tussen versies

35 bytes toegevoegd ,  12 jaar geleden
k
correcte structuur volgens pubchem
k (Aanmaak datum toevoegen aan Sjabloon:Beginnetje)
k (correcte structuur volgens pubchem)
{{Infobox chemische stof
| Naam = Luteoline-7-glucoside
| Afb1 = [[Afbeelding:Luteoline-7-glucoside.pngsvg|300px]]
| Afb1Omschr = Structuurformule van luteoline-7-glucoside
| Afb2 =
| Afb4Omschr =
| Formule = C<sub>21</sub>H<sub>20</sub>O<sub>11</sub>
| SMILES = c(c1)cC1=CC(=C(C=C4)Oc(c3CC1C2=CC(=O)4)ccC3=C(ccC=C(O)3C=C3O2)O[C@H](O2)4[C@@H](O)[C@@H](O)[C@@H](O)C2CO)cc(c(O)1)O[C@H]
(O4)CO)O)O)O)O)O)O
| IUPAC = 2-(3,4-dihydroxyfenyl)-7-(β-D-glucopyranosyloxy)-5-hydroxy-4H7-1-benzopyran[(2S,3R,4S,5S,6R)-3,4-on,
5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxychromen-4-on
| AndereNamen = cynaroside, cymaroside, glucoluteoline, 7-O-beta-D-Glucosyl-5,7,3',4'-tetrahydroxyflavon
| CAS = 5373-11-5
19.317

bewerkingen