Lugdunaam: verschil tussen versies

970 bytes toegevoegd ,  13 jaar geleden
sjabloon ingevoegd
k (cat)
(sjabloon ingevoegd)
{{ChemischeStof|
[[Afbeelding:Lugduname.png|thumb|Structuur van lugduname]]
| Naam = {{PAGENAME}}
'''Lugduname''' is een kunstmatige zoetstof die wordt beschouwd als de krachtigste [[zoetstof]] voor de mens. Een hoeveelheid lugduname is ongeveer 220.000 maal zoeter dan eenzelfde hoeveelheid [[sucrose]] (gewone suiker).
| Afb1 = [[Afbeelding:Lugduname.png|thumb|Structuur van lugduname200px]]
| Afb1Omschr = Structuur van lugdunaam
| Afb2 =
| Afb2Omschr =
| Afb3 =
| Afb3Omschr =
| Afb4 =
| Afb4Omschr =
De| brutoformuleFormule van lugduname is= C<sub>18</sub>H<sub>16</sub>N<sub>4</sub>O<sub>4</sub>. De [[moleculaire massa]] is 352,35 g/mol.
| Molgewicht = 352,35
| SMILES = OC(CN/C(NC3=CC=C(C#N)C=C3)=N\CC1=CC=CC2=C1OCO2)=O
| IUPAC =
| AndereNamen =
| CAS = 180045-75-4
| EG =
| VN =
| PubChem =
| Beschrijving =
| Vergelijkbaar =
| AfbWaarsch =
| TekstWaarsch =
| Carcinogeen =
| Hygroscopisch =
| Rzinnen =
| Szinnen =
| Omgang =
| Opslag =
| ADR =
| MAC =
| LethaalRat =
| LethaalKonijn =
| MSDS =
| Aggregatie = vast
| Kleur =
| Dichtheid =
| Smeltpunt =
| Kookpunt =
| Vlampunt =
| Zelfontbranding =
| Dampdruk =
| Brekingsindex =
| Oplosbaarheid =
| GoedOplIn =
| SlechtOplIn =
| OnoplIn =
| Dipoolmoment =
| Viscositeit =
| Kristalstructuur =
| fG0g =
| fG0l =
| fG0s =
| fH0g =
| fH0l =
| fH0s =
| S0g =
| S0l =
| S0s =
| Cpm0 =
| Evenwicht =
| KlassiekeAnalyse =
| Spectra =
| NutrientType =
| Essentieel =
| Voorkomen =
| ADI =
| AdditiefType = zoetstof
| E-nummer =
 
}}
De brutoformule van lugduname is C<sub>18</sub>H<sub>16</sub>N<sub>4</sub>O<sub>4</sub>. De [[moleculaire massa]] is 352,35 g/mol.
 
'''LugdunameLugdunaam''' is een kunstmatige zoetstof die wordt beschouwd als de krachtigste [[zoetstof]] voor de mens. Een hoeveelheid lugdunamelugdunaam is ongeveer 220.000 maal zoeter dan eenzelfde hoeveelheid [[sucrose]] (gewone suiker).
Lugduname behoort tot een groep van derivaten van [[guanidine]]; andere krachtige zoetstoffen in deze groep zijn:
 
* [[carrelame]] (ca. 160.000 zoeter dan sucrose);
LugdunameLugdunaam behoort tot een groep van derivaten van [[guanidine]]; andere krachtige zoetstoffen in deze groep zijn:
* [[sucrooctaat]] (160.000)
* [[carrelamecarrelaam]] (ca. 160.000 zoeter dan sucrose);
* [[sucrooctaatsucro-octaat]] (160.000)
* [[sucrononaat]] (160.000)
* [[bernardamebernardaam]] (200.000)
(ter vergelijking: [[aspartaam]] is ongeveer 200 keer zoeter dan suiker; [[sucralose]] ongeveer 600 keer).
 
19.316

bewerkingen